Pyridinium,3-bromo-1-[2-(4-chlorophenyl)-1-methyl-2-oxoethyl]-, bromide (1:1) structure
|
Common Name | Pyridinium,3-bromo-1-[2-(4-chlorophenyl)-1-methyl-2-oxoethyl]-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6276-17-1 | Molecular Weight | 405.51200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12Br2ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-bromopyridin-1-ium-1-yl)-1-(4-chlorophenyl)propan-1-one,bromide |
|---|
| Molecular Formula | C14H12Br2ClNO |
|---|---|
| Molecular Weight | 405.51200 |
| Exact Mass | 402.89700 |
| PSA | 20.95000 |
| LogP | 0.83790 |
| InChIKey | GWIXICFEFKQYRJ-UHFFFAOYSA-M |
| SMILES | CC(C(=O)c1ccc(Cl)cc1)[n+]1cccc(Br)c1.[Br-] |
|
~%
Pyridinium,3-br... CAS#:6276-17-1 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |