2,6-dimethyl-4-[(4-nitrophenyl)methylsulfanyl]-2H-pyran structure
|
Common Name | 2,6-dimethyl-4-[(4-nitrophenyl)methylsulfanyl]-2H-pyran | ||
|---|---|---|---|---|
| CAS Number | 6276-18-2 | Molecular Weight | 403.23500 | |
| Density | 1.25g/cm3 | Boiling Point | 428ºC at 760 mmHg | |
| Molecular Formula | C14H14INO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.7ºC | |
| Name | 2,6-dimethyl-4-[(4-nitrophenyl)methylsulfanyl]pyrylium,iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 428ºC at 760 mmHg |
| Molecular Formula | C14H14INO3S |
| Molecular Weight | 403.23500 |
| Flash Point | 212.7ºC |
| Exact Mass | 402.97400 |
| PSA | 84.26000 |
| LogP | 1.90520 |
| Index of Refraction | 1.61 |
| InChIKey | WBFGSKISQVORJC-UHFFFAOYSA-M |
| SMILES | Cc1cc(SCc2ccc([N+](=O)[O-])cc2)cc(C)[o+]1.[I-] |
|
~%
2,6-dimethyl-4-... CAS#:6276-18-2 |
| Literature: King et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 300 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,6-DIMETHYL-4-[(4-NITROPHENYL)METHYLSULFANYL]PYRYLIUM IODIDE |
| 2,6-dimethyl-4-(4-nitro-benzylsulfanyl)-pyrylium,iodide |
| 2,6-Dimethyl-4-(4-nitro-benzylmercapto)-pyrylium,Jodid |