1-(4-methoxyphenyl)-2-(3-methyl-3H-isoquinolin-2-yl)ethanone structure
|
Common Name | 1-(4-methoxyphenyl)-2-(3-methyl-3H-isoquinolin-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6276-47-7 | Molecular Weight | 419.25600 | |
| Density | 1.18g/cm3 | Boiling Point | 557.3ºC at 760 mmHg | |
| Molecular Formula | C19H18INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.9ºC | |
| Name | 1-(4-methoxyphenyl)-2-(3-methylisoquinolin-2-ium-2-yl)ethanone,iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 557.3ºC at 760 mmHg |
| Molecular Formula | C19H18INO2 |
| Molecular Weight | 419.25600 |
| Flash Point | 290.9ºC |
| Exact Mass | 419.03800 |
| PSA | 30.18000 |
| LogP | 0.33120 |
| Index of Refraction | 1.625 |
| InChIKey | YGJADMSIKDRCTJ-UHFFFAOYSA-M |
| SMILES | COc1ccc(C(=O)C[n+]2cc3ccccc3cc2C)cc1.[I-] |
|
~%
1-(4-methoxyphe... CAS#:6276-47-7 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1946 , vol. 68, p. 868 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(4-Methoxy-phenacyl)-3-methyl-isochinolinium,Jodid |
| 2-(4-methoxy-phenacyl)-3-methyl-isoquinolinium,iodide |
| 1-(4-METHOXYPHENYL)-2-(3-METHYLISOQUINOLIN-2-IUM-2-YL)ETHANONE IODIDE |