1-phenyl-2-pyridin-1-yl-propan-1-one structure
|
Common Name | 1-phenyl-2-pyridin-1-yl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 6276-64-8 | Molecular Weight | 292.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-2-pyridin-1-ium-1-ylpropan-1-one,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14BrNO |
|---|---|
| Molecular Weight | 292.17100 |
| Exact Mass | 291.02600 |
| PSA | 20.95000 |
| InChIKey | WKDDUKSMIOPUSV-UHFFFAOYSA-M |
| SMILES | CC(C(=O)c1ccccc1)[n+]1ccccc1.[Br-] |
|
~61%
1-phenyl-2-pyri... CAS#:6276-64-8 |
| Literature: Arai, Sadao; Yamazaki, Masuo; Hida, Mitsuhiko Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 4 p. 1073 - 1078 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-phenyl-2-pyridin-1-ium-1-ylpropan-1-one bromide |