2-(2-methyl-2H-pyridin-1-yl)-1-naphthalen-1-yl-ethanone structure
|
Common Name | 2-(2-methyl-2H-pyridin-1-yl)-1-naphthalen-1-yl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 6276-81-9 | Molecular Weight | 342.23000 | |
| Density | 1.119g/cm3 | Boiling Point | 456ºC at 760 mmHg | |
| Molecular Formula | C18H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.9ºC | |
| Name | 2-(2-methylpyridin-1-ium-1-yl)-1-naphthalen-1-ylethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 456ºC at 760 mmHg |
| Molecular Formula | C18H16BrNO |
| Molecular Weight | 342.23000 |
| Flash Point | 184.9ºC |
| Exact Mass | 341.04200 |
| PSA | 20.95000 |
| LogP | 0.32260 |
| Index of Refraction | 1.62 |
| InChIKey | GHTAKMIWEBFWET-UHFFFAOYSA-M |
| SMILES | Cc1cccc[n+]1CC(=O)c1cccc2ccccc12.[Br-] |
|
~%
2-(2-methyl-2H-... CAS#:6276-81-9 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1946 , vol. 68, p. 1131 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methyl-1-(2-[1]naphthyl-2-oxo-ethyl)-pyridinium,bromide |
| 2-Methyl-1-(2-[1]naphthyl-2-oxo-aethyl)-pyridinium,Bromid |
| 2-(2-METHYLPYRIDIN-1-IUM-1-YL)-1-NAPHTHALEN-1-YLETHANONE BROMIDE |