1,4-Dihydro-2-hydroxymethyl-4-(m-nitrophenyl)-6-methyl-3,5-pyridine dicarboxylic acid diethyl ester structure
|
Common Name | 1,4-Dihydro-2-hydroxymethyl-4-(m-nitrophenyl)-6-methyl-3,5-pyridine dicarboxylic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 62760-70-7 | Molecular Weight | 390.38700 | |
| Density | 1.284g/cm3 | Boiling Point | 551.6ºC at 760 mmHg | |
| Molecular Formula | C19H22N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.4ºC | |
| Name | diethyl 2-(hydroxymethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 551.6ºC at 760 mmHg |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.38700 |
| Flash Point | 287.4ºC |
| Exact Mass | 390.14300 |
| PSA | 130.68000 |
| LogP | 2.78020 |
| Index of Refraction | 1.563 |
| InChIKey | LWTWJBUKUVHABE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C)NC(CO)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
|
~65%
1,4-Dihydro-2-h... CAS#:62760-70-7 |
| Literature: Satoh; Ichihashi; Okumura Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 12 p. 3189 - 3201 |
|
~%
1,4-Dihydro-2-h... CAS#:62760-70-7 |
| Literature: Satoh; Ichihashi; Okumura Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 12 p. 3189 - 3201 |
|
~%
1,4-Dihydro-2-h... CAS#:62760-70-7 |
| Literature: Satoh; Ichihashi; Okumura Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 12 p. 3189 - 3201 |
| 1,4-Dihydro-2-hydroxymethyl-4-(m-nitrophenyl)-6-methyl-3,5-pyridine dicarboxylic acid diethyl ester |
| FR-7534 |
| diethyl 2-methyl-4-(3-nitrophenyl)-6-hydroxymethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| diethyl 2-hydroxymethyl-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |