5-(3-chloro-2-methyl-phenyl)-N-(9,10-dioxoanthracen-2-yl)furan-2-carboxamide structure
|
Common Name | 5-(3-chloro-2-methyl-phenyl)-N-(9,10-dioxoanthracen-2-yl)furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6277-40-3 | Molecular Weight | 561.83300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9Br3INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,5-dibromopyridin-1-ium-1-yl)-1-(4-iodophenyl)ethanone,bromide |
|---|
| Molecular Formula | C13H9Br3INO |
|---|---|
| Molecular Weight | 561.83300 |
| Exact Mass | 558.72800 |
| PSA | 20.95000 |
| LogP | 0.99060 |
| InChIKey | GJFQOMJUGOMBHU-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1cc(Br)cc(Br)c1)c1ccc(I)cc1.[Br-] |
|
~%
5-(3-chloro-2-m... CAS#:6277-40-3 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |