2-(6-chloroquinolin-1-yl)-1-(4-methoxyphenyl)ethanone structure
|
Common Name | 2-(6-chloroquinolin-1-yl)-1-(4-methoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6277-48-1 | Molecular Weight | 392.67400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(6-chloroquinolin-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone,bromide |
|---|
| Molecular Formula | C18H15BrClNO2 |
|---|---|
| Molecular Weight | 392.67400 |
| Exact Mass | 390.99700 |
| PSA | 30.18000 |
| LogP | 0.67620 |
| InChIKey | CMQWWRLZHNMHGU-UHFFFAOYSA-M |
| SMILES | COc1ccc(C(=O)C[n+]2cccc3cc(Cl)ccc32)cc1.[Br-] |
|
~%
2-(6-chloroquin... CAS#:6277-48-1 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |