methyl 2-[6-chloro-2-(2-methoxybenzoyl)imino-benzothiazol-3-yl]acetate structure
|
Common Name | methyl 2-[6-chloro-2-(2-methoxybenzoyl)imino-benzothiazol-3-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 6277-75-4 | Molecular Weight | 328.31900 | |
| Density | 1.277g/cm3 | Boiling Point | 520.6ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.3ºC | |
| Name | 4-nitro-3-(3-nitrophenyl)-1-phenylpentan-1-one |
|---|
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 520.6ºC at 760 mmHg |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.31900 |
| Flash Point | 247.3ºC |
| Exact Mass | 328.10600 |
| PSA | 108.71000 |
| LogP | 4.66300 |
| Index of Refraction | 1.594 |
| InChIKey | JSLKOOHYAWTKNJ-UHFFFAOYSA-N |
| SMILES | CC(C(CC(=O)c1ccccc1)c1cccc([N+](=O)[O-])c1)[N+](=O)[O-] |
|
~%
methyl 2-[6-chl... CAS#:6277-75-4 |
| Literature: Seter (Strumza),J. Israel Journal of Chemistry, 1966 , vol. 4, p. 1 - 5 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |