Pyridinium,3-methyl-1-[2-(2-naphthalenyl)-2-oxoethyl]-, bromide (1:1) structure
|
Common Name | Pyridinium,3-methyl-1-[2-(2-naphthalenyl)-2-oxoethyl]-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6277-80-1 | Molecular Weight | 342.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-methylpyridin-1-ium-1-yl)-1-naphthalen-2-ylethanone,bromide |
|---|
| Molecular Formula | C18H16BrNO |
|---|---|
| Molecular Weight | 342.23000 |
| Exact Mass | 341.04200 |
| PSA | 20.95000 |
| LogP | 0.32260 |
| InChIKey | VKCGUSVAJYNWSC-UHFFFAOYSA-M |
| SMILES | Cc1ccc[n+](CC(=O)c2ccc3ccccc3c2)c1.[Br-] |
|
~%
Pyridinium,3-me... CAS#:6277-80-1 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1946 , vol. 68, p. 1131 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |