Isoquinolinium,3-methyl-2-(2-phenylethyl)-, bromide (1:1) structure
|
Common Name | Isoquinolinium,3-methyl-2-(2-phenylethyl)-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6277-82-3 | Molecular Weight | 328.24600 | |
| Density | 1.08g/cm3 | Boiling Point | 476.2ºC at 760 mmHg | |
| Molecular Formula | C18H18BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.6ºC | |
| Name | 3-methyl-2-(2-phenylethyl)isoquinolin-2-ium,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 476.2ºC at 760 mmHg |
| Molecular Formula | C18H18BrN |
| Molecular Weight | 328.24600 |
| Flash Point | 211.6ºC |
| Exact Mass | 327.06200 |
| PSA | 3.88000 |
| LogP | 0.68240 |
| Index of Refraction | 1.626 |
| InChIKey | POLXWLODACMEKB-UHFFFAOYSA-M |
| SMILES | Cc1cc2ccccc2c[n+]1CCc1ccccc1.[Br-] |
|
~%
Isoquinolinium,... CAS#:6277-82-3 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1946 , vol. 68, p. 868 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Methyl-2-phenaethyl-isochinolinium,Bromid |
| 3-methyl-2-phenethyl-isoquinolinium,bromide |