3,5-diethyl-1-phenyl-2-propyl-2H-pyridine structure
|
Common Name | 3,5-diethyl-1-phenyl-2-propyl-2H-pyridine | ||
|---|---|---|---|---|
| CAS Number | 6277-85-6 | Molecular Weight | 381.29400 | |
| Density | 0.933g/cm3 | Boiling Point | 359.2ºC at 760mmHg | |
| Molecular Formula | C18H24IN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.3ºC | |
| Name | 3,5-diethyl-1-phenyl-2-propylpyridin-1-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.933g/cm3 |
|---|---|
| Boiling Point | 359.2ºC at 760mmHg |
| Molecular Formula | C18H24IN |
| Molecular Weight | 381.29400 |
| Flash Point | 154.3ºC |
| Exact Mass | 381.09500 |
| PSA | 3.88000 |
| LogP | 1.04460 |
| InChIKey | VNUPITXHVFOTOO-UHFFFAOYSA-M |
| SMILES | CCCc1c(CC)cc(CC)c[n+]1-c1ccccc1.[I-] |
|
~%
3,5-diethyl-1-p... CAS#:6277-85-6 |
| Literature: Craig et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 1624,1627 |
|
~%
3,5-diethyl-1-p... CAS#:6277-85-6 |
| Literature: Craig et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 1624,1627 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,5-diethyl-1-phenyl-2-propyl-pyridinium,iodide |
| 3,5-Diaethyl-1-phenyl-2-propyl-pyridinium,Jodid |