methyl 2-[2-(4-diethylaminobenzoyl)imino-6-nitro-benzothiazol-3-yl]acetate structure
|
Common Name | methyl 2-[2-(4-diethylaminobenzoyl)imino-6-nitro-benzothiazol-3-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 6278-16-6 | Molecular Weight | 369.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-2-(3-methylpyridin-1-ium-1-yl)ethanone,iodide |
|---|
| Molecular Formula | C15H16INO2 |
|---|---|
| Molecular Weight | 369.19800 |
| Exact Mass | 369.02300 |
| PSA | 30.18000 |
| InChIKey | YKGXRIBXSYILIO-UHFFFAOYSA-M |
| SMILES | COc1ccc(C(=O)C[n+]2cccc(C)c2)cc1.[I-] |
|
~%
methyl 2-[2-(4-... CAS#:6278-16-6 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1946 , vol. 68, p. 868 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |