Phenol,2-[(4-bromophenyl)methyl]-4-methyl- structure
|
Common Name | Phenol,2-[(4-bromophenyl)methyl]-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6279-12-5 | Molecular Weight | 277.15600 | |
| Density | 1.387g/cm3 | Boiling Point | 378.1ºC at 760 mmHg | |
| Molecular Formula | C14H13BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.5ºC | |
| Name | 2-[(4-bromophenyl)methyl]-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 378.1ºC at 760 mmHg |
| Molecular Formula | C14H13BrO |
| Molecular Weight | 277.15600 |
| Flash Point | 182.5ºC |
| Exact Mass | 276.01500 |
| PSA | 20.23000 |
| LogP | 4.05390 |
| Index of Refraction | 1.617 |
| InChIKey | ZKOYKWQHXBUOMI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(Cc2ccc(Br)cc2)c1 |
|
~%
Phenol,2-[(4-br... CAS#:6279-12-5 |
| Literature: Huston; Gyorgy Journal of the American Chemical Society, 1950 , vol. 72, p. 4171 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(4-Brom-benzyl)-4-methyl-phenol |
| 2-(4-bromo-benzyl)-4-methyl-phenol |