Phosphoric acid compound with N~1~-(7-chloro-3-methyl-4-quinolinyl)-N~2~,N~2~-diisobutyl-1,2-ethanediamine (1:1) structure
|
Common Name | Phosphoric acid compound with N~1~-(7-chloro-3-methyl-4-quinolinyl)-N~2~,N~2~-diisobutyl-1,2-ethanediamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6280-09-7 | Molecular Weight | 445.92000 | |
| Density | 1.43g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H33ClN3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(7-chloro-3-methylquinolin-4-yl)-N',N'-bis(2-methylpropyl)ethane-1,2-diamine |
|---|
| Density | 1.43g/cm3 |
|---|---|
| Molecular Formula | C20H33ClN3O4P |
| Molecular Weight | 445.92000 |
| Exact Mass | 445.19000 |
| PSA | 115.73000 |
| LogP | 4.36690 |
| Index of Refraction | 1.69 |
| InChIKey | RGLMFCRDXLXIBE-UHFFFAOYSA-N |
| SMILES | Cc1cnc2cc(Cl)ccc2c1NCCN(CC(C)C)CC(C)C |