Methanone, (3-chlorophenyl)(2-hydroxy-5-methylphenyl) structure
|
Common Name | Methanone, (3-chlorophenyl)(2-hydroxy-5-methylphenyl) | ||
|---|---|---|---|---|
| CAS Number | 6280-54-2 | Molecular Weight | 246.68900 | |
| Density | 1.27g/cm3 | Boiling Point | 381.7ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.6ºC | |
| Name | (3-chlorophenyl)-(2-hydroxy-5-methylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 381.7ºC at 760 mmHg |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.68900 |
| Flash Point | 184.6ºC |
| Exact Mass | 246.04500 |
| PSA | 37.30000 |
| LogP | 3.58500 |
| Index of Refraction | 1.613 |
| InChIKey | LGAUSQYBRVKFEO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(C(=O)c2cccc(Cl)c2)c1 |
|
~92%
Methanone, (3-c... CAS#:6280-54-2 |
| Literature: Venu; Shashikanth; Khanum; Naveen; Firdouse, Aiysha; Sridhar; Shashidhara Prasad Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 10 p. 3505 - 3514 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3'-Chlor-2-hydroxy-3-methyl-benzophenon |
| 3'-chloro-2-hydroxy-3-methyl-benzophenone |
| 3'-chloro-2-hydroxy-5-methyl-benzophenone |
| 2-Hydroxy-5-methyl-3'-chlorbenzophenon |
| 3'-Chlor-2-hydroxy-5-methyl-benzophenon |
| (3-chlorophenyl)(2-hydroxy-3-methylphenyl)methanone |