4-(4-methoxyphenyl)-2,3-diphenyl-1,2,4-oxadiazolidin-5-one structure
|
Common Name | 4-(4-methoxyphenyl)-2,3-diphenyl-1,2,4-oxadiazolidin-5-one | ||
|---|---|---|---|---|
| CAS Number | 62803-76-3 | Molecular Weight | 346.37900 | |
| Density | 1.259g/cm3 | Boiling Point | 488.4ºC at 760 mmHg | |
| Molecular Formula | C21H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.2ºC | |
| Name | 4-(4-methoxyphenyl)-2,3-diphenyl-1,2,4-oxadiazolidin-5-one |
|---|
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 488.4ºC at 760 mmHg |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.37900 |
| Flash Point | 249.2ºC |
| Exact Mass | 346.13200 |
| PSA | 42.01000 |
| LogP | 4.90220 |
| Index of Refraction | 1.632 |
| InChIKey | HUWSYXWWAWVCJY-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2C(=O)ON(c3ccccc3)C2c2ccccc2)cc1 |
|
~%
4-(4-methoxyphe... CAS#:62803-76-3 |
| Literature: Zalupsky,P. et al. Collection of Czechoslovak Chemical Communications, 1976 , vol. 41, p. 3799 - 3803 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |