N,N,N,N,2,2,4,11,13,13-decamethyltetradec-7-yne-6,9-diamine structure
|
Common Name | N,N,N,N,2,2,4,11,13,13-decamethyltetradec-7-yne-6,9-diamine | ||
|---|---|---|---|---|
| CAS Number | 6281-18-1 | Molecular Weight | 364.65100 | |
| Density | 0.859g/cm3 | Boiling Point | 418.5ºC at 760 mmHg | |
| Molecular Formula | C24H48N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.8ºC | |
| Name | 2,3-bis(dimethylamino)-1,4,2,3-dithiaborinane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.859g/cm3 |
|---|---|
| Boiling Point | 418.5ºC at 760 mmHg |
| Molecular Formula | C24H48N2 |
| Molecular Weight | 364.65100 |
| Flash Point | 178.8ºC |
| Exact Mass | 364.38200 |
| PSA | 6.48000 |
| LogP | 5.77500 |
| Index of Refraction | 1.47 |
| InChIKey | MFHYGSPZCFBNNN-UHFFFAOYSA-N |
| SMILES | CC(CC(C#CC(CC(C)CC(C)(C)C)N(C)C)N(C)C)CC(C)(C)C |
|
~%
N,N,N,N,2,2,4,1... CAS#:6281-18-1 |
| Literature: Fegley et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 4144 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| tetra-N-methyl-1,4-bis-(2,4,4-trimethyl-pentyl)-but-2-ynediyldiamine |
| tetra-N-methyl-[1,4,2,3]dithiadiborinane-2,3-diamine |
| 2,3-Bis(dimethylamino)-1,4,2,3-dithiadiborinane |
| 1,4,2,3-Dithiadiborinane-2,3-diamine,N,N,N',N'-tetramethyl |
| Tetra-N-methyl-1,4-bis-(2,4,4-trimethyl-pentyl)-but-2-indiyldiamin |