2-cyclohexyl-4-nitrophenol structure
|
Common Name | 2-cyclohexyl-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 6281-53-4 | Molecular Weight | 221.25200 | |
| Density | 1.222g/cm3 | Boiling Point | 313.8ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9ºC | |
| Name | 2-cyclohexyl-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 313.8ºC at 760 mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 129.9ºC |
| Exact Mass | 221.10500 |
| PSA | 66.05000 |
| LogP | 3.87130 |
| Index of Refraction | 1.583 |
| InChIKey | JXGVRKOUPGWANZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c(C2CCCCC2)c1 |
|
~%
2-cyclohexyl-4-... CAS#:6281-53-4 |
| Literature: Blank,B. et al. Journal of Medicinal Chemistry, 1963 , vol. 6, p. 554 - 560 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS3085O19 |
| 4-Nitro-2-cyclohexyl-phenol |
| Phenol,2-cyclohexyl-4-nitro |