1-(2-methyl-4-oxo-pentan-2-yl)-3-naphthalen-1-yl-thiourea structure
|
Common Name | 1-(2-methyl-4-oxo-pentan-2-yl)-3-naphthalen-1-yl-thiourea | ||
|---|---|---|---|---|
| CAS Number | 6281-69-2 | Molecular Weight | 300.41900 | |
| Density | 1.187g/cm3 | Boiling Point | 453.2ºC at 760 mmHg | |
| Molecular Formula | C17H20N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.9ºC | |
| Name | 1-(2-methyl-4-oxopentan-2-yl)-3-naphthalen-1-ylthiourea |
|---|
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 453.2ºC at 760 mmHg |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.41900 |
| Flash Point | 227.9ºC |
| Exact Mass | 300.13000 |
| PSA | 73.22000 |
| LogP | 4.34780 |
| Index of Refraction | 1.65 |
| InChIKey | XCCMHNCFIKSYPF-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)(C)NC(=S)Nc1cccc2ccccc12 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|