3-Pyridinecarbonitrile,1,2-dihydro-4-(methoxymethyl)-6-methyl-5-nitro-2-oxo
3-Pyridinecarbonitrile,1,2-dihydro-4-(methoxymethyl)-6-methyl-5-nitro-2-oxo structure
|
Common Name | 3-Pyridinecarbonitrile,1,2-dihydro-4-(methoxymethyl)-6-methyl-5-nitro-2-oxo | ||
|---|---|---|---|---|
| CAS Number | 6281-75-0 | Molecular Weight | 223.18500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 5-Cyano-6-hydroxy-4-methoxymethyl-2-methyl-3-nitropy啶（4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile），Chinese name: 5-Cyano-6-hydroxy-4-methoxymethyl-2-methyl-3-nitropy啶，CAS number: 6281-75-0，molecular formula: C9H9N3O4，molecular weight: 223.18500，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9N3O4 |
|---|---|
| Molecular Weight | 223.18500 |
| Exact Mass | 223.05900 |
| PSA | 111.70000 |
| LogP | 1.13278 |
| InChIKey | FDZPYSHPLURJEA-UHFFFAOYSA-N |
| SMILES | COCc1c([N+](=O)[O-])c(C)[nH]c(=O)c1C#N |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:35623-09-7
CAS#:719-48-2
CAS#:6333-70-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Nitropyridone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile? |
| A: The English name of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile is 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile. |
| Q: What is the CAS number of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile? |
| A: CAS number of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile is 6281-75-0. |
| Q: What is the SMILES notation of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile? |
| A: SMILES notation of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile is COCc1c([N+](=O)[O-])c(C)[nH]c(=O)c1C#N. |
| Q: What is the LogP of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile? |
| A: LogP of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile is 1.13278. |
| Q: What is the molecular formula of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile? |
| A: Molecular formula of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile is C9H9N3O4. |
| Q: What are the downstream products of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile? |
| A: Related downstream products(CAS) of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile: 35623-09-7;719-48-2;6333-70-6. |
| Q: What English synonyms does 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile have? |
| A: English synonyms of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile: Nitropyridone. |
| Q: What is the molecular weight of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile? |
| A: Molecular weight of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile is 223.18500. |
| Q: What is the polar surface area (PSA) of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile? |
| A: Polar surface area (PSA) of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile is 111.70000. |
| Q: What is the InChIKey of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile? |
| A: InChIKey of 4-(methoxymethyl)-6-methyl-5-nitro-2-oxo-1H-pyridine-3-carbonitrile is FDZPYSHPLURJEA-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |