2-amino-4-methyl-9H-pyrimido[5,4-b][1,4]oxazepine-6,8-dione structure
|
Common Name | 2-amino-4-methyl-9H-pyrimido[5,4-b][1,4]oxazepine-6,8-dione | ||
|---|---|---|---|---|
| CAS Number | 62812-13-9 | Molecular Weight | 208.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-4-methyl-9H-pyrimido[5,4-b][1,4]oxazepine-6,8-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8N4O3 |
|---|---|
| Molecular Weight | 208.17400 |
| Exact Mass | 208.06000 |
| PSA | 111.42000 |
| InChIKey | HTCYZMYMYZGXAZ-UHFFFAOYSA-N |
| SMILES | Cc1nc(N)nc2c1OC(=O)CC(=O)N2 |
|
~%
2-amino-4-methy... CAS#:62812-13-9 |
| Literature: Kato; Oda; Ito Chemical and Pharmaceutical Bulletin, 1977 , vol. 25, # 3 p. 491 - 494 |
|
~%
2-amino-4-methy... CAS#:62812-13-9 |
| Literature: Kato; Oda; Ito Chemical and Pharmaceutical Bulletin, 1977 , vol. 25, # 3 p. 491 - 494 |
| Pyrimido[5,4-b][1,4]oxazepine-6,8(7H,9H)-dione,2-amino-4-methyl |