propyl 4-tert-butylbenzoate structure
|
Common Name | propyl 4-tert-butylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 6282-27-5 | Molecular Weight | 220.30700 | |
| Density | 0.97g/cm3 | Boiling Point | 295.5ºC at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.4ºC | |
| Name | propyl 4-tert-butylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 295.5ºC at 760 mmHg |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 131.4ºC |
| Exact Mass | 220.14600 |
| PSA | 26.30000 |
| LogP | 3.55090 |
| Index of Refraction | 1.49 |
| InChIKey | IFFIRJMHMXRNHD-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)c1ccc(C(C)(C)C)cc1 |
|
~61%
propyl 4-tert-b... CAS#:6282-27-5 |
| Literature: Nobuta, Tomoya; Fujiya, Akitoshi; Hirashima, Shin-Ichi; Tada, Norihiro; Miura, Tsuyoshi; Itoh, Akichika Tetrahedron Letters, 2012 , vol. 53, # 39 p. 5306 - 5308 |
|
~67%
propyl 4-tert-b... CAS#:6282-27-5 |
| Literature: Tada, Norihiro; Ikebata, Yuki; Nobuta, Tomoya; Hirashima, Shin-Ichi; Miura, Tsuyoshi; Itoh, Akichika Photochemical and Photobiological Sciences, 2012 , vol. 11, # 4 p. 616 - 619 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-tert.-Butyl-benzoesaeure-propylester |