3-Bromo-4-methyl-5-nitroaniline structure
|
Common Name | 3-Bromo-4-methyl-5-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 62827-39-8 | Molecular Weight | 231.047 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 346.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H7BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.1±26.5 °C | |
| Name | 3-bromo-4-methyl-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 346.0±37.0 °C at 760 mmHg |
| Molecular Formula | C7H7BrN2O2 |
| Molecular Weight | 231.047 |
| Flash Point | 163.1±26.5 °C |
| Exact Mass | 229.969086 |
| PSA | 71.84000 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | FJRVWYCECCQKPB-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)cc(N)cc1[N+](=O)[O-] |
| HS Code | 2921430090 |
|---|
|
~%
3-Bromo-4-methy... CAS#:62827-39-8 |
| Literature: Jain, K. K.; Pujari, H. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 4 p. 294 - 295 |
|
~%
3-Bromo-4-methy... CAS#:62827-39-8 |
| Literature: Jain, K. K.; Pujari, H. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 4 p. 294 - 295 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-bromo-4-methyl-3-nitrophenylamine |
| 3-Bromo-5-nitro-p-toluidine |
| 4-Amino-2-bromo-6-nitrotoluol |
| 5-Amino1-bromo-2-methyl-3-nitrobenzene |
| 3-Bromo-4-methyl-5-nitroaniline |
| Benzenamine, 3-bromo-4-methyl-5-nitro- |
| 3-Brom-5-nitro-p-toluidin |