1-Bromo-5-methoxy-2-methyl-3-nitrobenzene structure
|
Common Name | 1-Bromo-5-methoxy-2-methyl-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 62827-41-2 | Molecular Weight | 246.058 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 307.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.5±26.5 °C | |
| Name | 1-bromo-5-methoxy-2-methyl-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.1±37.0 °C at 760 mmHg |
| Molecular Formula | C8H8BrNO3 |
| Molecular Weight | 246.058 |
| Flash Point | 139.5±26.5 °C |
| Exact Mass | 244.968750 |
| PSA | 55.05000 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | VMHCFQWEXWUPFT-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)c(C)c([N+](=O)[O-])c1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Bromo-5-methoxy-2-methyl-3-nitrobenzene |
| 4-Methoxy-2-brom-6-nitrotoluol |
| Benzene, 1-bromo-5-methoxy-2-methyl-3-nitro- |
| Benzene,1-bromo-5-methoxy-2-methyl-3-nitro |
| 2-Bromo-4-methoxy-6-nitrotoluene |