6-(diphenylcarbamoyl)pyridine-2-carboxylic acid structure
|
Common Name | 6-(diphenylcarbamoyl)pyridine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 628282-47-3 | Molecular Weight | 318.32600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(diphenylcarbamoyl)pyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H14N2O3 |
|---|---|
| Molecular Weight | 318.32600 |
| Exact Mass | 318.10000 |
| PSA | 70.50000 |
| LogP | 3.75830 |
| InChIKey | GNOBQOPUOWZHJL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(C(=O)N(c2ccccc2)c2ccccc2)n1 |
|
~%
6-(diphenylcarb... CAS#:628282-47-3 |
| Literature: An, Bao-Li; Gong, Meng-Lian; Li, Ming-Xing; Zhang, Ji-Ming Journal of Molecular Structure, 2004 , vol. 687, # 1-3 p. 1 - 6 |
|
~%
6-(diphenylcarb... CAS#:628282-47-3 |
| Literature: An, Bao-Li; Gong, Meng-Lian; Li, Ming-Xing; Zhang, Ji-Ming Journal of Molecular Structure, 2004 , vol. 687, # 1-3 p. 1 - 6 |
| 2-Pyridinecarboxylic acid,6-[(diphenylamino)carbonyl] |
| 6-diphenylamine carbonyl 2-pyridine carboxylic acid |