3,3-dimethyl-1,4-diphenylazetidin-2-imine structure
|
Common Name | 3,3-dimethyl-1,4-diphenylazetidin-2-imine | ||
|---|---|---|---|---|
| CAS Number | 62834-02-0 | Molecular Weight | 250.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-dimethyl-1,4-diphenylazetidin-2-imine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18N2 |
|---|---|
| Molecular Weight | 250.33800 |
| Exact Mass | 250.14700 |
| PSA | 27.09000 |
| LogP | 4.41610 |
| InChIKey | YFADXHQYCDZCSF-UHFFFAOYSA-N |
| SMILES | CC1(C)C(=N)N(c2ccccc2)C1c1ccccc1 |
|
~%
3,3-dimethyl-1,... CAS#:62834-02-0 |
| Literature: Marchand-Brynaert, Jacqueline; Moya-Portuguez, Manuel; Huber, Isabelle; Ghosez, Leon Journal of the Chemical Society, Chemical Communications, 1983 , # 15 p. 818 - 819 |
| 2-Azetidinimine,3,3-dimethyl-1,4-diphenyl |
| 3,3-Dimethyl-1,4-diphenyl-2-azetidinimine |