3-(2-aminoethyl)-2-phenyl-quinazolin-4-one structure
|
Common Name | 3-(2-aminoethyl)-2-phenyl-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 62838-20-4 | Molecular Weight | 265.31000 | |
| Density | 1.23g/cm3 | Boiling Point | 454.2ºC at 760 mmHg | |
| Molecular Formula | C16H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.5ºC | |
| Name | 3-(2-aminoethyl)-2-phenylquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 454.2ºC at 760 mmHg |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.31000 |
| Flash Point | 228.5ºC |
| Exact Mass | 265.12200 |
| PSA | 60.91000 |
| LogP | 2.72250 |
| Index of Refraction | 1.652 |
| InChIKey | OUTJVLKVOHOPPK-UHFFFAOYSA-N |
| SMILES | NCCn1c(-c2ccccc2)nc2ccccc2c1=O |
| HS Code | 2933990090 |
|---|
|
~%
3-(2-aminoethyl... CAS#:62838-20-4 |
| Literature: Dash, B.; Dora, E. K.; Panda, C. S. Journal of the Indian Chemical Society, 1980 , vol. 57, # 8 p. 835 - 836 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-Aminoethyl)-2-phenyl-4(3H)-quinazolinone |
| 3-(2-AMINOETHYL)-2-PHENYLQUINAZOLIN-4(3H)-ONE |
| 2-Phenyl-3-(2-aminoethyl)-3H-chinazolin-4-on |
| 3-(2-amino-ethyl)-2-phenyl-3H-quinazolin-4-one |