2-(2,6-diaminopurin-9-yl)-6-methyl-oxane-3,4,5-triol structure
|
Common Name | 2-(2,6-diaminopurin-9-yl)-6-methyl-oxane-3,4,5-triol | ||
|---|---|---|---|---|
| CAS Number | 6284-37-3 | Molecular Weight | 296.28300 | |
| Density | 2.11g/cm3 | Boiling Point | 728.3ºC at 760 mmHg | |
| Molecular Formula | C11H16N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 394.2ºC | |
| Name | 2-(2,6-diaminopurin-9-yl)-6-methyloxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.11g/cm3 |
|---|---|
| Boiling Point | 728.3ºC at 760 mmHg |
| Molecular Formula | C11H16N6O4 |
| Molecular Weight | 296.28300 |
| Flash Point | 394.2ºC |
| Exact Mass | 296.12300 |
| PSA | 165.56000 |
| Index of Refraction | 1.921 |
| InChIKey | ZSMPROJUPCHKEF-UHFFFAOYSA-N |
| SMILES | CC1OC(n2cnc3c(N)nc(N)nc32)C(O)C(O)C1O |
|
~%
2-(2,6-diaminop... CAS#:6284-37-3 |
| Literature: Baker; Hewson Journal of Organic Chemistry, 1957 , vol. 22, p. 959,965 |
|
~%
2-(2,6-diaminop... CAS#:6284-37-3 |
| Literature: Baker; Hewson Journal of Organic Chemistry, 1957 , vol. 22, p. 959,965 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 9-(6-deoxyhexopyranosyl)-9h-purine-2,6-diamine |
| (6R)-6-(2,6-Diamino-purin-9-yl)-2,6-anhydro-1-desoxy-L-mannit |
| (6R)-6-(2,6-diamino-purin-9-yl)-2,6-anhydro-1-deoxy-L-mannitol |