5-methoxy-9-(2-methoxyphenyl)benzo[f][2]benzofuran-1,3-dione structure
|
Common Name | 5-methoxy-9-(2-methoxyphenyl)benzo[f][2]benzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 62849-01-8 | Molecular Weight | 334.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methoxy-9-(2-methoxyphenyl)benzo[f][2]benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H14O5 |
|---|---|
| Molecular Weight | 334.32200 |
| Exact Mass | 334.08400 |
| PSA | 61.83000 |
| LogP | 3.83460 |
| InChIKey | OJLVJCFQPJCLGM-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1c2c(cc3c(OC)cccc13)C(=O)OC2=O |
|
~%
5-methoxy-9-(2-... CAS#:62849-01-8 |
| Literature: Baddar Journal of the Chemical Society, 1947 , p. 224,226 |
|
~%
5-methoxy-9-(2-... CAS#:62849-01-8 |
| Literature: Baddar Journal of the Chemical Society, 1947 , p. 224,226 |
| Naphtho[2,3-c]furan-1,3-dione,8-methoxy-4-(2-methoxyphenyl) |
| 5-Methoxy-1-(2-methoxy-phenyl)-naphthalin-2,3-dicarbonsaeure-anhydrid |
| 5-methoxy-1-(2-methoxy-phenyl)-naphthalene-2,3-dicarboxylic acid-anhydride |