1-(2-hydroperoxypropan-2-yl)-4-tert-butyl-benzene structure
|
Common Name | 1-(2-hydroperoxypropan-2-yl)-4-tert-butyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 6285-32-1 | Molecular Weight | 208.29700 | |
| Density | 0.991g/cm3 | Boiling Point | 314.6ºC at 760 mmHg | |
| Molecular Formula | C13H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.1ºC | |
| Name | 1-tert-butyl-4-(2-hydroperoxypropan-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.991g/cm3 |
|---|---|
| Boiling Point | 314.6ºC at 760 mmHg |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.29700 |
| Flash Point | 144.1ºC |
| Exact Mass | 208.14600 |
| PSA | 29.46000 |
| LogP | 3.70880 |
| Index of Refraction | 1.498 |
| InChIKey | HSYSVFXBQIIBBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(C)(C)OO)cc1 |
|
~%
1-(2-hydroperox... CAS#:6285-32-1 |
| Literature: Cooper Journal of the Chemical Society, 1953 , p. 1267,1271 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1-(4-tert-butyl-phenyl)-1-methyl-ethyl hydroperoxide |
| p-tert-Butylcumolhydroperoxid |
| hydroperoxide,p-tert-butyl-|A,|A-dimethylbenzyl |
| p-tert-Butylcumene hydroperoxide |
| 1-(4-tert-Butyl-phenyl)-1-methyl-aethylhydroperoxid |