Benzenepropanaminium, g-[(butylamino)carbonyl]-N,N,N,a-tetramethyl-g-phenyl-, bromide (9CI) structure
|
Common Name | Benzenepropanaminium, g-[(butylamino)carbonyl]-N,N,N,a-tetramethyl-g-phenyl-, bromide (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6285-48-9 | Molecular Weight | 367.54800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H35N2O+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-(butylamino)-5-oxo-4,4-diphenylpentan-2-yl]-trimethylazanium |
|---|
| Molecular Formula | C24H35N2O+ |
|---|---|
| Molecular Weight | 367.54800 |
| Exact Mass | 367.27500 |
| PSA | 29.10000 |
| LogP | 4.76470 |
| InChIKey | UOTWGGSDGGVJLU-UHFFFAOYSA-O |
| SMILES | CCCCNC(=O)C(CC(C)[N+](C)(C)C)(c1ccccc1)c1ccccc1 |
|
~%
Benzenepropanam... CAS#:6285-48-9 |
| Literature: Moffett; Aspergren Journal of the American Chemical Society, 1957 , vol. 79, p. 4462,4464, 4465 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |