Propanedioic acid,2-(1-methylbutyl)-2-(2-propen-1-yl)-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-(1-methylbutyl)-2-(2-propen-1-yl)-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6285-59-2 | Molecular Weight | 270.36500 | |
| Density | 0.97g/cm3 | Boiling Point | 294.4ºC at 760 mmHg | |
| Molecular Formula | C15H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.3ºC | |
| Name | (1-Methylbutyl)-2-propenylpropanedioic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 294.4ºC at 760 mmHg |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.36500 |
| Flash Point | 129.3ºC |
| Exact Mass | 270.18300 |
| PSA | 52.60000 |
| LogP | 3.11130 |
| Index of Refraction | 1.449 |
| InChIKey | VTRMVPBHEGUYBA-UHFFFAOYSA-N |
| SMILES | C=CCC(C(=O)OCC)(C(=O)OCC)C(C)CCC |
|
~%
Propanedioic ac... CAS#:6285-59-2 |
| Literature: E.Lilly and Co. Patent: US1842293 , 1931 ; |
|
~%
Propanedioic ac... CAS#:6285-59-2 |
| Literature: Abe et al. Yakugaku Zasshi, 1955 , vol. 75, p. 891 Chem.Abstr., 1956 , p. 4979 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| allyl-(1-methyl-butyl)-malonic acid diethyl ester |
| Allyl-(1-methyl-butyl)-malonsaeure-diaethylester |
| diethyl (1-methylbutyl)allylmalonate |