[1,1'-Biphenyl]-4,4'-dicarboxylicacid, 2,2'-dinitro-, 4,4'-diethyl ester structure
|
Common Name | [1,1'-Biphenyl]-4,4'-dicarboxylicacid, 2,2'-dinitro-, 4,4'-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6285-96-7 | Molecular Weight | 388.32800 | |
| Density | 1.352g/cm3 | Boiling Point | 533.9ºC at 760 mmHg | |
| Molecular Formula | C18H16N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.1ºC | |
| Name | 2,2'-dinitro-biphenyl-4,4'-dicarboxylic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 533.9ºC at 760 mmHg |
| Molecular Formula | C18H16N2O8 |
| Molecular Weight | 388.32800 |
| Flash Point | 215.1ºC |
| Exact Mass | 388.09100 |
| PSA | 144.24000 |
| LogP | 4.56980 |
| Index of Refraction | 1.588 |
| InChIKey | VFQUPNHLZHNWDS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C(=O)OCC)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
|
~%
[1,1'-Biphenyl]... CAS#:6285-96-7 |
| Literature: Searle; Adams Journal of the American Chemical Society, 1933 , vol. 55, p. 1649,1652 |
|
~%
[1,1'-Biphenyl]... CAS#:6285-96-7 |
| Literature: Searle; Adams Journal of the American Chemical Society, 1933 , vol. 55, p. 1649,1652 |
|
~%
[1,1'-Biphenyl]... CAS#:6285-96-7 |
| Literature: Searle; Adams Journal of the American Chemical Society, 1933 , vol. 55, p. 1649,1652 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,2'-Dinitro-4,4'-diethoxycarbonyl-biphenyl |
| 2,2'-Dinitro-biphenyl-4,4'-dicarbonsaeure-diaethylester |