2-bromo-3-nitro-benzoyl chloride structure
|
Common Name | 2-bromo-3-nitro-benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 6286-36-8 | Molecular Weight | 264.46100 | |
| Density | 1.838g/cm3 | Boiling Point | 294.6ºC at 760 mmHg | |
| Molecular Formula | C7H3BrClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132ºC | |
| Name | 2-bromo-3-nitrobenzoic acid chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.838g/cm3 |
|---|---|
| Boiling Point | 294.6ºC at 760 mmHg |
| Molecular Formula | C7H3BrClNO3 |
| Molecular Weight | 264.46100 |
| Flash Point | 132ºC |
| Exact Mass | 262.89800 |
| PSA | 62.89000 |
| LogP | 3.25950 |
| Index of Refraction | 1.623 |
| InChIKey | BETVLJMOJDGFLC-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cccc([N+](=O)[O-])c1Br |
| HS Code | 2916399090 |
|---|
|
~99%
2-bromo-3-nitro... CAS#:6286-36-8 |
| Literature: Chen, Yin-Bo; Li, Ji-Ling; Shao, Xu-Sheng; Xu, Xiao-Yong; Li, Zhong Chinese Chemical Letters, 2013 , vol. 24, # 8 p. 673 - 676 |
|
~%
2-bromo-3-nitro... CAS#:6286-36-8 |
| Literature: Lamm,B.; Liedholm,B. Acta Chemica Scandinavica (1947-1973), 1967 , vol. 21, p. 2679 - 2688 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Brom-3-nitro-benzoylchlorid |
| 2-bromo-3-nitro-benzoyl chloride |