5-ethyl-2,4-dinitro-phenol structure
|
Common Name | 5-ethyl-2,4-dinitro-phenol | ||
|---|---|---|---|---|
| CAS Number | 6286-38-0 | Molecular Weight | 212.16000 | |
| Density | 1.469g/cm3 | Boiling Point | 342.6ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | 5-ethyl-2,4-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 342.6ºC at 760 mmHg |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16000 |
| Flash Point | 150.7ºC |
| Exact Mass | 212.04300 |
| PSA | 111.87000 |
| LogP | 2.81740 |
| Index of Refraction | 1.62 |
| InChIKey | LAQLVAJTFUCYLF-UHFFFAOYSA-N |
| SMILES | CCc1cc(O)c([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
5-ethyl-2,4-din... CAS#:6286-38-0 |
| Literature: Sen; Sharma Journal of the Indian Chemical Society, 1957 , vol. 34, p. 877,879 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Aethyl-2,4-dinitro-phenol |
| 5-ethyl-2,4-dinitro-phenol |