diethyl 2-benzo[1,3]dioxol-5-yl-4-hydroxy-4-methyl-6-oxo-cyclohexane-1,3-dicarboxylate structure
|
Common Name | diethyl 2-benzo[1,3]dioxol-5-yl-4-hydroxy-4-methyl-6-oxo-cyclohexane-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 6286-69-7 | Molecular Weight | 392.40000 | |
| Density | 1.299g/cm3 | Boiling Point | 525.9ºC at 760 mmHg | |
| Molecular Formula | C20H24O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.7ºC | |
| Name | diethyl 2-(1,3-benzodioxol-5-yl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 525.9ºC at 760 mmHg |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40000 |
| Flash Point | 181.7ºC |
| Exact Mass | 392.14700 |
| PSA | 108.36000 |
| LogP | 1.58130 |
| Index of Refraction | 1.547 |
| InChIKey | HSXXKYCRIUTPKT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)CC(C)(O)C(C(=O)OCC)C1c1ccc2c(c1)OCO2 |
|
~84%
diethyl 2-benzo... CAS#:6286-69-7 |
| Literature: Brown; Dhal; Papin Tetrahedron, 1995 , vol. 51, # 47 p. 13061 - 13072 |
|
~%
diethyl 2-benzo... CAS#:6286-69-7 |
| Literature: Walker Journal of the American Chemical Society, 1955 , vol. 77, p. 3664,3666 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| diethyl 2-(benzo[d][1,3]dioxol-5-yl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| 2,4-diethoxycarbonyl-5-hydroxy-5-methyl-3-(3,4-methylenedioxyphenyl)cyclohexan-1-one |
| 2-benzo[1,3]dioxol-5-yl-4-hydroxy-4-methyl-6-oxo-cyclohexane-1,3-dicarboxylic acid diethyl ester |
| 2-Benzo[1,3]dioxol-5-yl-4-hydroxy-4-methyl-6-oxo-cyclohexan-1,3-dicarbonsaeure-diaethylester |