2-(3-fluorophenyl)-1,5-dimethyl-pyrazol-3-one
2-(3-fluorophenyl)-1,5-dimethyl-pyrazol-3-one structure
|
Common Name | 2-(3-fluorophenyl)-1,5-dimethyl-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 6286-80-2 | Molecular Weight | 206.21600 | |
| Density | 1.234g/cm3 | Boiling Point | 293.7ºC at 760 mmHg | |
| Molecular Formula | C11H11FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.4ºC | |
Summary: 2-(3-Fluorophenyl)-1,5-dimethylpyrazol-3-one (Chinese name: 2-(3-氟苯基)-1,5-二甲基吡唑-3-酮, CAS number: 6286-80-2, molecular formula: C11H11FN2O, molecular weight: 206.21600), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 293.7ºC at 760 mmHg |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.21600 |
| Flash Point | 131.4ºC |
| Exact Mass | 206.08600 |
| PSA | 26.93000 |
| LogP | 1.62350 |
| Index of Refraction | 1.566 |
| InChIKey | GFRLRQFXBGYRAQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)n(-c2cccc(F)c2)n1C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one? |
| A: Polar surface area (PSA) of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one is 26.93000. |
| Q: What is the CAS number of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one? |
| A: CAS number of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one is 6286-80-2. |
| Q: What is the SMILES notation of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one? |
| A: SMILES notation of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one is Cc1cc(=O)n(-c2cccc(F)c2)n1C. |
| Q: What is the molecular formula of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one? |
| A: Molecular formula of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one is C11H11FN2O. |
| Q: What is the LogP of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one? |
| A: LogP of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one is 1.62350. |
| Q: What are the upstream materials of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one? |
| A: Related upstream materials(CAS) of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one: 658-27-5;77-78-1. |
| Q: What is the Chinese name of 6286-80-2? |
| A: Chinese name of 6286-80-2 is 6286-80-2. |
| Q: What is the molecular weight of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one? |
| A: Molecular weight of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one is 206.21600. |
| Q: What is the boiling point of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one? |
| A: Boiling point of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one is 293.7ºC at 760 mmHg. |
| Q: What is the InChIKey of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one? |
| A: InChIKey of 2-(3-fluorophenyl)-1,5-dimethylpyrazol-3-one is GFRLRQFXBGYRAQ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |