2-Propenoic acid,3-[2-(acetyloxy)phenyl]-, methyl ester, (2E)- structure
|
Common Name | 2-Propenoic acid,3-[2-(acetyloxy)phenyl]-, methyl ester, (2E)- | ||
|---|---|---|---|---|
| CAS Number | 6286-83-5 | Molecular Weight | 220.22100 | |
| Density | 1.64g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Acetyloxyphenyl propyl ketone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Exact Mass | 220.07400 |
| PSA | 52.60000 |
| LogP | 1.79810 |
| Index of Refraction | 1.678 |
| InChIKey | KFIPHURDCQOVSB-BQYQJAHWSA-N |
| SMILES | COC(=O)C=Cc1ccccc1OC(C)=O |
|
~%
2-Propenoic aci... CAS#:6286-83-5 |
| Literature: Ziegler,C.B.; Heck,R.F. Journal of Organic Chemistry, 1978 , vol. 43, p. 2941 - 2946 |
|
~%
2-Propenoic aci... CAS#:6286-83-5 |
| Literature: Stelmach,H.; Connors,K.A. Journal of the American Chemical Society, 1970 , vol. 92, # 4 p. 863 - 866 |
| o-Acetoxyzimtsaeuremethylester |
| 1-Butanone,2-(acetyloxy)-1-phenyl |
| Butyrophenone,2'-hydroxy-,acetate (8CI) |
| 1-Butanone,1-[2-(acetyloxy)phenyl] |
| 2-ACETOXYBUTYROPHENONE |
| o-Acetoxy-butyrophenon |