3,3-bis(phenylsulfanyl)heptan-2-ol structure
|
Common Name | 3,3-bis(phenylsulfanyl)heptan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 62870-21-7 | Molecular Weight | 332.52300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-bis(phenylsulfanyl)heptan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24OS2 |
|---|---|
| Molecular Weight | 332.52300 |
| Exact Mass | 332.12700 |
| PSA | 70.83000 |
| LogP | 5.83830 |
| InChIKey | SQFHJAQGFCJHRL-UHFFFAOYSA-N |
| SMILES | CCCCC(Sc1ccccc1)(Sc1ccccc1)C(C)O |
|
~%
3,3-bis(phenyls... CAS#:62870-21-7 |
| Literature: Blatcher,P.; Warren,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 1074 - 1088 |
|
~%
3,3-bis(phenyls... CAS#:62870-21-7 |
| Literature: Blatcher,P.; Warren,S. Journal of the Chemical Society, Chemical Communications, 1976 , p. 1055 - 1056 |
| 2-Heptanol,3,3-bis(phenylthio) |
| 3,3-Bis-(phenylthio)-heptan-2-ol |