n-isobutyl diethylphosphonoacetamide
n-isobutyl diethylphosphonoacetamide structure
|
Common Name | n-isobutyl diethylphosphonoacetamide | ||
|---|---|---|---|---|
| CAS Number | 62872-62-2 | Molecular Weight | 251.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H22NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | n-isobutyl diethylphosphonoacetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H22NO4P |
|---|---|
| Molecular Weight | 251.26000 |
| Exact Mass | 251.12900 |
| PSA | 74.44000 |
| LogP | 2.41560 |
| InChIKey | FQAYSONYHAHHRJ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC(=O)NCC(C)C)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
n-isobutyl diet... CAS#:62872-62-2 |
| Literature: TSUMURA and CO.; Aoki, Katsuyuki Patent: US2013/245303 A1, 2013 ; Location in patent: Paragraph 0084; 0085; 0086 ; |
|
~%
n-isobutyl diet... CAS#:62872-62-2 |
| Literature: TSUMURA and CO.; Aoki, Katsuyuki Patent: US2013/245303 A1, 2013 ; |
|
~%
n-isobutyl diet... CAS#:62872-62-2 |
| Literature: Landor; Odyek Journal of the Chemical Society. Perkin transactions 1, 1977 , vol. 2, p. 93 - 95 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Diethyl N-Isobutylcarbamoylmethylphosphonat |
| diethylphosphorylmethyl methyl sulfoxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of n-isobutyl diethylphosphonoacetamide? |
| A: Molecular weight of n-isobutyl diethylphosphonoacetamide is 251.26000. |
| Q: What is the LogP of n-isobutyl diethylphosphonoacetamide? |
| A: LogP of n-isobutyl diethylphosphonoacetamide is 2.41560. |
| Q: What is the Chinese name of 62872-62-2? |
| A: Chinese name of 62872-62-2 is 62872-62-2. |
| Q: What English synonyms does n-isobutyl diethylphosphonoacetamide have? |
| A: English synonyms of n-isobutyl diethylphosphonoacetamide: Diethyl N-Isobutylcarbamoylmethylphosphonat, diethylphosphorylmethyl methyl sulfoxide. |
| Q: What is the English name of n-isobutyl diethylphosphonoacetamide? |
| A: The English name of n-isobutyl diethylphosphonoacetamide is n-isobutyl diethylphosphonoacetamide. |
| Q: What is the SMILES notation of n-isobutyl diethylphosphonoacetamide? |
| A: SMILES notation of n-isobutyl diethylphosphonoacetamide is CCOP(=O)(CC(=O)NCC(C)C)OCC. |
| Q: What is the molecular formula of n-isobutyl diethylphosphonoacetamide? |
| A: Molecular formula of n-isobutyl diethylphosphonoacetamide is C10H22NO4P. |
| Q: What is the CAS number of n-isobutyl diethylphosphonoacetamide? |
| A: CAS number of n-isobutyl diethylphosphonoacetamide is 62872-62-2. |
| Q: What is the InChIKey of n-isobutyl diethylphosphonoacetamide? |
| A: InChIKey of n-isobutyl diethylphosphonoacetamide is FQAYSONYHAHHRJ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of n-isobutyl diethylphosphonoacetamide? |
| A: Polar surface area (PSA) of n-isobutyl diethylphosphonoacetamide is 74.44000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |