4-(Hydroxy(oxido)amino)-N-(2-(hydroxy(oxido)amino)benzylidene)benzenesulfonohydrazide structure
|
Common Name | 4-(Hydroxy(oxido)amino)-N-(2-(hydroxy(oxido)amino)benzylidene)benzenesulfonohydrazide | ||
|---|---|---|---|---|
| CAS Number | 6288-06-8 | Molecular Weight | 350.30700 | |
| Density | 1.555g/cm3 | Boiling Point | 572.257ºC at 760 mmHg | |
| Molecular Formula | C13H10N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.891ºC | |
| Name | 4-nitro-N-[(E)-(2-nitrophenyl)methylideneamino]benzenesulfonamide |
|---|
| Density | 1.555g/cm3 |
|---|---|
| Boiling Point | 572.257ºC at 760 mmHg |
| Molecular Formula | C13H10N4O6S |
| Molecular Weight | 350.30700 |
| Flash Point | 299.891ºC |
| Exact Mass | 350.03200 |
| PSA | 158.55000 |
| LogP | 4.33350 |
| Index of Refraction | 1.674 |
| InChIKey | WXFHZVPXVCAKMD-NTEUORMPSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NN=Cc2ccccc2[N+](=O)[O-])cc1 |
|
~%
4-(Hydroxy(oxid... CAS#:6288-06-8 |
| Literature: Cameron; Storrie Journal of the Chemical Society, 1934 , p. 1330 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |