1-(dibutylcarbamoyl)ethyl acetate structure
|
Common Name | 1-(dibutylcarbamoyl)ethyl acetate | ||
|---|---|---|---|---|
| CAS Number | 6288-19-3 | Molecular Weight | 243.34200 | |
| Density | 0.968g/cm3 | Boiling Point | 331.6ºC at 760 mmHg | |
| Molecular Formula | C13H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.3ºC | |
| Name | 2-acetoxy-propionic acid dibutylamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.968g/cm3 |
|---|---|
| Boiling Point | 331.6ºC at 760 mmHg |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.34200 |
| Flash Point | 154.3ºC |
| Exact Mass | 243.18300 |
| PSA | 46.61000 |
| LogP | 2.36680 |
| Index of Refraction | 1.451 |
| InChIKey | FCKCOYRIFOWGCE-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C(=O)C(C)OC(C)=O |
|
~%
1-(dibutylcarba... CAS#:6288-19-3 |
| Literature: Ratchford; Lengel; Fisher Journal of the American Chemical Society, 1949 , vol. 71, p. 648,650 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-Acetoxy-propionsaeure-[bis-(2-acetoxy-propyl)-amid] |
| O-Acetyl-milchsaeure-dibutylamid |
| 2-acetoxy-propionic acid-[bis-(2-acetoxy-propyl)-amide] |
| 2-Acetoxy-propionsaeure-dibutylamid |
| 1-{[2-(acetyloxy)propanoyl][2-(acetyloxy)propyl]amino}propan-2-yl acetate |