4-(4-arsorosophenyl)sulfonylmorpholine structure
|
Common Name | 4-(4-arsorosophenyl)sulfonylmorpholine | ||
|---|---|---|---|---|
| CAS Number | 6288-64-8 | Molecular Weight | 318.20100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13AsNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-arsorosophenyl)sulfonylmorpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13AsNO4S |
|---|---|
| Molecular Weight | 318.20100 |
| Exact Mass | 317.97800 |
| PSA | 72.06000 |
| LogP | 0.51370 |
| InChIKey | IWDSLDAFUXXGEC-UHFFFAOYSA-N |
| SMILES | O=[As]c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
|
~%
4-(4-arsorosoph... CAS#:6288-64-8 |
| Literature: Way; Oneto Journal of the American Chemical Society, 1942 , vol. 64, p. 1287 |
|
~%
4-(4-arsorosoph... CAS#:6288-64-8 |
| Literature: Way; Oneto Journal of the American Chemical Society, 1942 , vol. 64, p. 1287 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-(4-arsenoso-benzenesulfonyl)-morpholine |
| 4-{[4-(oxoarsanyl)phenyl]sulfonyl}morpholine |
| 4-(4-Arsenoso-benzolsulfonyl)-morpholin |