Acetic acid, 2-bromo-,2-[4-(1,1-dimethylethyl)phenoxy]ethyl ester structure
|
Common Name | Acetic acid, 2-bromo-,2-[4-(1,1-dimethylethyl)phenoxy]ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6289-76-5 | Molecular Weight | 315.20300 | |
| Density | 1.279g/cm3 | Boiling Point | 360.2ºC at 760mmHg | |
| Molecular Formula | C14H19BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.7ºC | |
| Name | 2-(4-tert-butylphenoxy)ethyl 2-bromoacetate |
|---|
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 360.2ºC at 760mmHg |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.20300 |
| Flash Point | 171.7ºC |
| Exact Mass | 314.05200 |
| PSA | 35.53000 |
| LogP | 3.30100 |
| Index of Refraction | 1.518 |
| InChIKey | KZPGNETTXSBYOX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OCCOC(=O)CBr)cc1 |
|
~%
Acetic acid, 2-... CAS#:6289-76-5 |
| Literature: Gertler et al. Journal of Agricultural and Food Chemistry, 1958 , vol. 6, p. 843 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |