3-(3,5-Dichloro-4-methylbenzoyl)propionic acid structure
|
Common Name | 3-(3,5-Dichloro-4-methylbenzoyl)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 62903-05-3 | Molecular Weight | 261.10100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,5-dichloro-4-methylphenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10Cl2O3 |
|---|---|
| Molecular Weight | 261.10100 |
| Exact Mass | 260.00100 |
| PSA | 54.37000 |
| LogP | 3.34930 |
| InChIKey | WCJIEUHCYAYRFE-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)cc(C(=O)CCC(=O)O)cc1Cl |
| HS Code | 2918300090 |
|---|
|
~%
3-(3,5-Dichloro... CAS#:62903-05-3 |
| Literature: Sankyo Company Limited Patent: US4052395 A1, 1977 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(3,5-dichloro-4-methylphenyl)-4-oxobutyric acid |
| 3-(3,5-Dichloro-4-methylbenzoyl)propionic acid |