1-(4-ethoxyphenyl)-N-(4-fluorophenyl)methanimine structure
|
Common Name | 1-(4-ethoxyphenyl)-N-(4-fluorophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 62907-32-8 | Molecular Weight | 243.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-ethoxyphenyl)-N-(4-fluorophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14FNO |
|---|---|
| Molecular Weight | 243.27600 |
| Exact Mass | 243.10600 |
| PSA | 21.59000 |
| LogP | 3.97500 |
| InChIKey | SFVJMQHBQRAPAL-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C=Nc2ccc(F)cc2)cc1 |
|
~%
1-(4-ethoxyphen... CAS#:62907-32-8 |
| Literature: Sakagami, Sakumitsu; Nakamizo, Minoru Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 1 p. 265 - 266 |
| N-[(E)-(4-ethoxyphenyl)methylidene]-4-fluoroaniline |