3-methoxypropane-1,2-diol,nitric acid structure
|
Common Name | 3-methoxypropane-1,2-diol,nitric acid | ||
|---|---|---|---|---|
| CAS Number | 62908-43-4 | Molecular Weight | 232.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H12N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methoxypropane-1,2-diol,nitric acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H12N2O9 |
|---|---|
| Molecular Weight | 232.14600 |
| Exact Mass | 232.05400 |
| PSA | 181.79000 |
| InChIKey | SSUDHTPTGHHYDI-UHFFFAOYSA-N |
| SMILES | COCC(O)CO.O=[N+]([O-])O.O=[N+]([O-])O |
|
~%
3-methoxypropan... CAS#:62908-43-4 |
| Literature: Jones Journal of the Chemical Society, 1919 , vol. 115, p. 77 |
| 1-Methoxy-2,3-bis-nitryloxy-propan |
| 1-methoxy-2,3-bis-nitryloxy-propane |
| 1-methoxy-2,3-bis-nitrooxy-propane |
| 1,2-Propanediol,3-methoxy-,dinitrate |