2-methoxy-3-nitro-4-[(E)-2-nitroethenyl]phenol structure
|
Common Name | 2-methoxy-3-nitro-4-[(E)-2-nitroethenyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 6291-50-5 | Molecular Weight | 240.17000 | |
| Density | 1.492g/cm3 | Boiling Point | 441.7ºC at 760 mmHg | |
| Molecular Formula | C9H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 2-methoxy-3-nitro-4-(2-nitroethenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 441.7ºC at 760 mmHg |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.17000 |
| Flash Point | 220.9ºC |
| Exact Mass | 240.03800 |
| PSA | 121.10000 |
| LogP | 2.60280 |
| Index of Refraction | 1.649 |
| InChIKey | ZAUXRJBGUWQKHU-SNAWJCMRSA-N |
| SMILES | COc1c(O)ccc(C=C[N+](=O)[O-])c1[N+](=O)[O-] |
|
~64%
2-methoxy-3-nit... CAS#:6291-50-5 |
| Literature: Dharmasens, Priyanthi; Oliveira-Campos, Ana-M. R.; Queiroz, Maria-Joao R. P.; Shannon, Patric V. R. Journal of Chemical Research, Miniprint, 1996 , # 1 p. 316 - 363 |
|
~%
2-methoxy-3-nit... CAS#:6291-50-5 |
| Literature: Dharmasens, Priyanthi; Oliveira-Campos, Ana-M. R.; Queiroz, Maria-Joao R. P.; Shannon, Patric V. R. Journal of Chemical Research, Miniprint, 1996 , # 1 p. 316 - 363 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzene,1-ethenyl-2-(1-methylethoxy)-3-nitro |
| 2-isopropoxy-3-nitrostyrene |
| 3-nitro-2-isopropoxystyrene |
| 3-Nitro-2-methoxy-4-(2t-nitro-vinyl-(1r))-phenol |