Rifamycin,N,15-didehydro-15-deoxo-3,15-[methylene(methylimino)]- (9CI) structure
|
Common Name | Rifamycin,N,15-didehydro-15-deoxo-3,15-[methylene(methylimino)]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 62921-36-2 | Molecular Weight | 722.82100 | |
| Density | 1.35g/cm3 | Boiling Point | 843.2ºC at 760mmHg | |
| Molecular Formula | C39H50N2O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 463.7ºC | |
| Name | N,15-didehydro-15-deoxo-3,15-epi(methano(methylimino))rifamycin SV |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 843.2ºC at 760mmHg |
| Molecular Formula | C39H50N2O11 |
| Molecular Weight | 722.82100 |
| Flash Point | 463.7ºC |
| Exact Mass | 722.34100 |
| PSA | 187.81000 |
| LogP | 4.66450 |
| Index of Refraction | 1.614 |
| InChIKey | ZYHLDBIMLCCGJP-HYUMRFKVSA-N |
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c5c(c(O)c4c3C2=O)CN(C)C(=N5)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C |
|
~%
Rifamycin,N,15-... CAS#:62921-36-2 |
| Literature: McCarthy; Moore; Wysong; Aldrich Journal of Medicinal Chemistry, 1977 , vol. 20, # 10 p. 1272 - 1276 |
|
~%
Rifamycin,N,15-... CAS#:62921-36-2 |
| Literature: Tsukamoto; Taguchi; Aikawa Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2309 - 2317 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |